C17H23Cl2NO3 — CID 90225387
tert-butyl 4-(3,5-dichlorophenyl)-4-hydroxyazepane-1-carboxylate (PubChem CID 90225387) has the molecular formula C17H23Cl2NO3 and a molecular weight of 360.28 g/mol. Its IUPAC name is tert-butyl 4-(3,5-dichlorophenyl)-4-hydroxyazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(3,5-dichlorophenyl)-4-hydroxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 90225387 |
| Molecular Formula | C17H23Cl2NO3 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | tert-butyl 4-(3,5-dichlorophenyl)-4-hydroxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)(c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23Cl2NO3/c1-16(2,3)23-15(21)20-7-4-5-17(22,6-8-20)12-9-13(18)11-14(19)10-12/h9-11,22H,4-8H2,1-3H3 |
| InChIKey | UDTDGZLOTIXWLG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |