C18H22ClNO3S — CID 21268335
tert-butyl 4-(5-chloro-1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 21268335) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-chloro-1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 21268335 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | tert-butyl 4-(5-chloro-1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2csc3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C18H22ClNO3S/c1-17(2,3)23-16(21)20-8-6-18(22,7-9-20)14-11-24-15-5-4-12(19)10-13(14)15/h4-5,10-11,22H,6-9H2,1-3H3 |
| InChIKey | IQZMCVMFRVQRQC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |