C23H32N2O3 — CID 67170370
tert-butyl 4-[4-(2,5-dimethylpyrrol-1-yl)-2-methylphenyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 67170370) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl 4-[4-(2,5-dimethylpyrrol-1-yl)-2-methylphenyl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2,5-dimethylpyrrol-1-yl)-2-methylphenyl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67170370 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | tert-butyl 4-[4-(2,5-dimethylpyrrol-1-yl)-2-methylphenyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | Cc1cc(-n2c(C)ccc2C)ccc1C1(O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H32N2O3/c1-16-15-19(25-17(2)7-8-18(25)3)9-10-20(16)23(27)11-13-24(14-12-23)21(26)28-22(4,5)6/h7-10,15,27H,11-14H2,1-6H3 |
| InChIKey | GVWNEZZDZFZUMZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|