C18H22BrNO2 — CID 10451390
tert-butyl 5-bromospiro[indene-1,4'-piperidine]-1'-carboxylate (PubChem CID 10451390) has the molecular formula C18H22BrNO2 and a molecular weight of 364.28 g/mol. Its IUPAC name is tert-butyl 5-bromospiro[indene-1,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 5-bromospiro[indene-1,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 10451390 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | tert-butyl 5-bromospiro[indene-1,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C=Cc3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C18H22BrNO2/c1-17(2,3)22-16(21)20-10-8-18(9-11-20)7-6-13-12-14(19)4-5-15(13)18/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | NOBHFAKDJUWMKO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |