C19H24BrNO3 — CID 118863986
tert-butyl 4-(6-bromo-2H-chromen-3-yl)piperidine-1-carboxylate (PubChem CID 118863986) has the molecular formula C19H24BrNO3 and a molecular weight of 394.31 g/mol. Its IUPAC name is tert-butyl 4-(6-bromo-2H-chromen-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-bromo-2H-chromen-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118863986 |
| Molecular Formula | C19H24BrNO3 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | tert-butyl 4-(6-bromo-2H-chromen-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2=Cc3cc(Br)ccc3OC2)CC1 |
| InChI | InChI=1S/C19H24BrNO3/c1-19(2,3)24-18(22)21-8-6-13(7-9-21)15-10-14-11-16(20)4-5-17(14)23-12-15/h4-5,10-11,13H,6-9,12H2,1-3H3 |
| InChIKey | IQHNOZRFOCRWTP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |