C14H14BrNO3 — CID 79029938
(6-bromo-2H-chromen-3-yl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 79029938) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is (6-bromo-2H-chromen-3-yl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (6-bromo-2H-chromen-3-yl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 79029938 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | (6-bromo-2H-chromen-3-yl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(C1=Cc2cc(Br)ccc2OC1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C14H14BrNO3/c15-11-1-2-13-9(6-11)5-10(8-19-13)14(18)16-4-3-12(17)7-16/h1-2,5-6,12,17H,3-4,7-8H2/t12-/m0/s1 |
| InChIKey | MVGDOCGIYYFGTD-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |