C17H20BrNO2 — CID 36713025
(6-bromo-2H-chromen-3-yl)-[(3R,5R)-3,5-dimethylpiperidin-1-yl]methanone (PubChem CID 36713025) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is (6-bromo-2H-chromen-3-yl)-[(3R,5R)-3,5-dimethylpiperidin-1-yl]methanone.
| Compound Name | (6-bromo-2H-chromen-3-yl)-[(3R,5R)-3,5-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 36713025 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (6-bromo-2H-chromen-3-yl)-[(3R,5R)-3,5-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)C2=Cc3cc(Br)ccc3OC2)C1 |
| InChI | InChI=1S/C17H20BrNO2/c1-11-5-12(2)9-19(8-11)17(20)14-6-13-7-15(18)3-4-16(13)21-10-14/h3-4,6-7,11-12H,5,8-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | NVBOFHBDWKZEGE-VXGBXAGGSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |