C16H18BrNO3 — CID 103280040
6-bromo-N-[(3-hydroxycyclopentyl)methyl]-2H-chromene-3-carboxamide (PubChem CID 103280040) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is 6-bromo-N-[(3-hydroxycyclopentyl)methyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-bromo-N-[(3-hydroxycyclopentyl)methyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 103280040 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 6-bromo-N-[(3-hydroxycyclopentyl)methyl]-2H-chromene-3-carboxamide |
| SMILES | O=C(NCC1CCC(O)C1)C1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C16H18BrNO3/c17-13-2-4-15-11(7-13)6-12(9-21-15)16(20)18-8-10-1-3-14(19)5-10/h2,4,6-7,10,14,19H,1,3,5,8-9H2,(H,18,20) |
| InChIKey | VPHVMNGHJMPYEQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |