C15H18BrNO3S — CID 103801126
6-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2H-chromene-3-carboxamide (PubChem CID 103801126) has the molecular formula C15H18BrNO3S and a molecular weight of 372.28 g/mol. Its IUPAC name is 6-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 103801126 |
| Molecular Formula | C15H18BrNO3S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 6-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2H-chromene-3-carboxamide |
| SMILES | O=C(NCCSCCCO)C1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C15H18BrNO3S/c16-13-2-3-14-11(9-13)8-12(10-20-14)15(19)17-4-7-21-6-1-5-18/h2-3,8-9,18H,1,4-7,10H2,(H,17,19) |
| InChIKey | YSJDXUAEEZABBH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|