C17H13BrClNO2 — CID 22578485
6-bromo-N-[(3-chlorophenyl)methyl]-2H-chromene-3-carboxamide (PubChem CID 22578485) has the molecular formula C17H13BrClNO2 and a molecular weight of 378.65 g/mol. Its IUPAC name is 6-bromo-N-[(3-chlorophenyl)methyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-bromo-N-[(3-chlorophenyl)methyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 22578485 |
| Molecular Formula | C17H13BrClNO2 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 6-bromo-N-[(3-chlorophenyl)methyl]-2H-chromene-3-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)C1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C17H13BrClNO2/c18-14-4-5-16-12(8-14)7-13(10-22-16)17(21)20-9-11-2-1-3-15(19)6-11/h1-8H,9-10H2,(H,20,21) |
| InChIKey | GMGIVXKGGZKRPY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |