C14H13BrN4O2 — CID 64546411
6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-2H-chromene-3-carboxamide (PubChem CID 64546411) has the molecular formula C14H13BrN4O2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 64546411 |
| Molecular Formula | C14H13BrN4O2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-2H-chromene-3-carboxamide |
| SMILES | O=C(NCCc1ncn[nH]1)C1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C14H13BrN4O2/c15-11-1-2-12-9(6-11)5-10(7-21-12)14(20)16-4-3-13-17-8-18-19-13/h1-2,5-6,8H,3-4,7H2,(H,16,20)(H,17,18,19) |
| InChIKey | ZQMVBWCGIGQIJT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |