C22H22ClN3O3 — CID 60524707
N-[3-[[(6-chloro-2H-chromene-3-carbonyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 60524707) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[3-[[(6-chloro-2H-chromene-3-carbonyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[(6-chloro-2H-chromene-3-carbonyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 60524707 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[3-[[(6-chloro-2H-chromene-3-carbonyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)N2CCCC2)c1)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-18-6-7-20-16(12-18)11-17(14-29-20)21(27)24-13-15-4-3-5-19(10-15)25-22(28)26-8-1-2-9-26/h3-7,10-12H,1-2,8-9,13-14H2,(H,24,27)(H,25,28) |
| InChIKey | BLAQMSPQZYHGMA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |