C25H31N3O2 — CID 52690341
N-[3-[[(4-cyclohexylbenzoyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 52690341) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[3-[[(4-cyclohexylbenzoyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[(4-cyclohexylbenzoyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 52690341 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[3-[[(4-cyclohexylbenzoyl)amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)N2CCCC2)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c29-24(22-13-11-21(12-14-22)20-8-2-1-3-9-20)26-18-19-7-6-10-23(17-19)27-25(30)28-15-4-5-16-28/h6-7,10-14,17,20H,1-5,8-9,15-16,18H2,(H,26,29)(H,27,30) |
| InChIKey | YUXDLKFJWMZCJS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |