C26H32N4O3 — CID 55862384
N-[3-[[[3-(cyclohexanecarbonylamino)benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 55862384) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[3-[[[3-(cyclohexanecarbonylamino)benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[3-(cyclohexanecarbonylamino)benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 55862384 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-[3-[[[3-(cyclohexanecarbonylamino)benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)N2CCCC2)c1)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C26H32N4O3/c31-24(21-11-7-13-23(17-21)28-25(32)20-9-2-1-3-10-20)27-18-19-8-6-12-22(16-19)29-26(33)30-14-4-5-15-30/h6-8,11-13,16-17,20H,1-5,9-10,14-15,18H2,(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | WGCFWLCVSQBDQA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |