C25H27N3O4 — CID 55893148
N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 55893148) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55893148 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C(NCc1cccc(NC(=O)C2CCCC2)c1)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C25H27N3O4/c29-22-12-13-23(30)28(22)16-17-8-10-20(11-9-17)24(31)26-15-18-4-3-7-21(14-18)27-25(32)19-5-1-2-6-19/h3-4,7-11,14,19H,1-2,5-6,12-13,15-16H2,(H,26,31)(H,27,32) |
| InChIKey | OESHZOXXLARSTJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|