C21H23N3O5 — CID 119182068
2-[3-[[3-(pyrrolidine-1-carbonylamino)phenyl]methylcarbamoyl]phenoxy]acetic acid (PubChem CID 119182068) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[3-[[3-(pyrrolidine-1-carbonylamino)phenyl]methylcarbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[3-(pyrrolidine-1-carbonylamino)phenyl]methylcarbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119182068 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[3-[[3-(pyrrolidine-1-carbonylamino)phenyl]methylcarbamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C(=O)NCc2cccc(NC(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C21H23N3O5/c25-19(26)14-29-18-8-4-6-16(12-18)20(27)22-13-15-5-3-7-17(11-15)23-21(28)24-9-1-2-10-24/h3-8,11-12H,1-2,9-10,13-14H2,(H,22,27)(H,23,28)(H,25,26) |
| InChIKey | LGAONQAFNPDEDP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |