C27H29N3O3 — CID 92872821
(3S)-3-[3-[(3-methoxyphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 92872821) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is (3S)-3-[3-[(3-methoxyphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | (3S)-3-[3-[(3-methoxyphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 92872821 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (3S)-3-[3-[(3-methoxyphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cccc([C@@H]3CCCN(C(=O)Nc4ccccc4)C3)c2)c1 |
| InChI | InChI=1S/C27H29N3O3/c1-33-25-14-5-8-20(16-25)18-28-26(31)22-10-6-9-21(17-22)23-11-7-15-30(19-23)27(32)29-24-12-3-2-4-13-24/h2-6,8-10,12-14,16-17,23H,7,11,15,18-19H2,1H3,(H,28,31)(H,29,32)/t23-/m1/s1 |
| InChIKey | AIUHNXXYHSYOPM-HSZRJFAPSA-N |
| XLogP | 5.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |