C28H30ClN3O2 — CID 46334145
3-[3-[(3-chlorophenyl)methylcarbamoyl]phenyl]-N-(4-ethylphenyl)piperidine-1-carboxamide (PubChem CID 46334145) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 3-[3-[(3-chlorophenyl)methylcarbamoyl]phenyl]-N-(4-ethylphenyl)piperidine-1-carboxamide.
| Compound Name | 3-[3-[(3-chlorophenyl)methylcarbamoyl]phenyl]-N-(4-ethylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46334145 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[3-[(3-chlorophenyl)methylcarbamoyl]phenyl]-N-(4-ethylphenyl)piperidine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCCC(c3cccc(C(=O)NCc4cccc(Cl)c4)c3)C2)cc1 |
| InChI | InChI=1S/C28H30ClN3O2/c1-2-20-11-13-26(14-12-20)31-28(34)32-15-5-9-24(19-32)22-7-4-8-23(17-22)27(33)30-18-21-6-3-10-25(29)16-21/h3-4,6-8,10-14,16-17,24H,2,5,9,15,18-19H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | LLNCNIHUFXKOIP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |