C26H26ClN3O2 — CID 92872490
(3R)-3-[3-(benzylcarbamoyl)phenyl]-N-(4-chlorophenyl)piperidine-1-carboxamide (PubChem CID 92872490) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is (3R)-3-[3-(benzylcarbamoyl)phenyl]-N-(4-chlorophenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[3-(benzylcarbamoyl)phenyl]-N-(4-chlorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 92872490 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (3R)-3-[3-(benzylcarbamoyl)phenyl]-N-(4-chlorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cccc([C@H]2CCCN(C(=O)Nc3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C26H26ClN3O2/c27-23-11-13-24(14-12-23)29-26(32)30-15-5-10-22(18-30)20-8-4-9-21(16-20)25(31)28-17-19-6-2-1-3-7-19/h1-4,6-9,11-14,16,22H,5,10,15,17-18H2,(H,28,31)(H,29,32)/t22-/m0/s1 |
| InChIKey | BUILMBTXWLRGFR-QFIPXVFZSA-N |
| XLogP | 5.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |