C27H29N3O2S — CID 46334219
3-[3-[(4-methylsulfanylphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 46334219) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is 3-[3-[(4-methylsulfanylphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 3-[3-[(4-methylsulfanylphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46334219 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3-[3-[(4-methylsulfanylphenyl)methylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | CSc1ccc(CNC(=O)c2cccc(C3CCCN(C(=O)Nc4ccccc4)C3)c2)cc1 |
| InChI | InChI=1S/C27H29N3O2S/c1-33-25-14-12-20(13-15-25)18-28-26(31)22-8-5-7-21(17-22)23-9-6-16-30(19-23)27(32)29-24-10-3-2-4-11-24/h2-5,7-8,10-15,17,23H,6,9,16,18-19H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | OOSJGNILYKWAER-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |