C27H37N5O2 — CID 46334212
3-[3-[2-(4-ethylpiperazin-1-yl)ethylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 46334212) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 3-[3-[2-(4-ethylpiperazin-1-yl)ethylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 3-[3-[2-(4-ethylpiperazin-1-yl)ethylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46334212 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 3-[3-[2-(4-ethylpiperazin-1-yl)ethylcarbamoyl]phenyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | CCN1CCN(CCNC(=O)c2cccc(C3CCCN(C(=O)Nc4ccccc4)C3)c2)CC1 |
| InChI | InChI=1S/C27H37N5O2/c1-2-30-16-18-31(19-17-30)15-13-28-26(33)23-9-6-8-22(20-23)24-10-7-14-32(21-24)27(34)29-25-11-4-3-5-12-25/h3-6,8-9,11-12,20,24H,2,7,10,13-19,21H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | IRFIGRVHVYRUKD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |