C29H41N5O2 — CID 92872765
(3S)-N-(4-ethylphenyl)-3-[3-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]piperidine-1-carboxamide (PubChem CID 92872765) has the molecular formula C29H41N5O2 and a molecular weight of 491.68 g/mol. Its IUPAC name is (3S)-N-(4-ethylphenyl)-3-[3-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]piperidine-1-carboxamide.
| Compound Name | (3S)-N-(4-ethylphenyl)-3-[3-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 92872765 |
| Molecular Formula | C29H41N5O2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | (3S)-N-(4-ethylphenyl)-3-[3-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]piperidine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCC[C@@H](c3cccc(C(=O)NCCCN4CCN(C)CC4)c3)C2)cc1 |
| InChI | InChI=1S/C29H41N5O2/c1-3-23-10-12-27(13-11-23)31-29(36)34-16-5-9-26(22-34)24-7-4-8-25(21-24)28(35)30-14-6-15-33-19-17-32(2)18-20-33/h4,7-8,10-13,21,26H,3,5-6,9,14-20,22H2,1-2H3,(H,30,35)(H,31,36)/t26-/m1/s1 |
| InChIKey | TWWAEBKPHKFLSB-AREMUKBSSA-N |
| XLogP | 4.03 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|