C28H35N3O3 — CID 46333982
3-[1-(4-ethylbenzoyl)piperidin-3-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide (PubChem CID 46333982) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-[1-(4-ethylbenzoyl)piperidin-3-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide.
| Compound Name | 3-[1-(4-ethylbenzoyl)piperidin-3-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 46333982 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 3-[1-(4-ethylbenzoyl)piperidin-3-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
| SMILES | CCc1ccc(C(=O)N2CCCC(c3cccc(C(=O)NCCCN4CCCC4=O)c3)C2)cc1 |
| InChI | InChI=1S/C28H35N3O3/c1-2-21-11-13-22(14-12-21)28(34)31-17-4-9-25(20-31)23-7-3-8-24(19-23)27(33)29-15-6-18-30-16-5-10-26(30)32/h3,7-8,11-14,19,25H,2,4-6,9-10,15-18,20H2,1H3,(H,29,33) |
| InChIKey | HKMJSDWFTKIJTR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|