C29H36N2O2 — CID 92872415
N-[2-(cyclohexen-1-yl)ethyl]-3-[(3S)-1-(4-ethylbenzoyl)piperidin-3-yl]benzamide (PubChem CID 92872415) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[(3S)-1-(4-ethylbenzoyl)piperidin-3-yl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(3S)-1-(4-ethylbenzoyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 92872415 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(3S)-1-(4-ethylbenzoyl)piperidin-3-yl]benzamide |
| SMILES | CCc1ccc(C(=O)N2CCC[C@@H](c3cccc(C(=O)NCCC4=CCCCC4)c3)C2)cc1 |
| InChI | InChI=1S/C29H36N2O2/c1-2-22-13-15-24(16-14-22)29(33)31-19-7-12-27(21-31)25-10-6-11-26(20-25)28(32)30-18-17-23-8-4-3-5-9-23/h6,8,10-11,13-16,20,27H,2-5,7,9,12,17-19,21H2,1H3,(H,30,32)/t27-/m1/s1 |
| InChIKey | WJROBJRHEADZEZ-HHHXNRCGSA-N |
| XLogP | 5.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|