C26H32N2O2 — CID 46333971
N-cyclopentyl-3-[1-(4-ethylbenzoyl)piperidin-3-yl]benzamide (PubChem CID 46333971) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-cyclopentyl-3-[1-(4-ethylbenzoyl)piperidin-3-yl]benzamide.
| Compound Name | N-cyclopentyl-3-[1-(4-ethylbenzoyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 46333971 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-cyclopentyl-3-[1-(4-ethylbenzoyl)piperidin-3-yl]benzamide |
| SMILES | CCc1ccc(C(=O)N2CCCC(c3cccc(C(=O)NC4CCCC4)c3)C2)cc1 |
| InChI | InChI=1S/C26H32N2O2/c1-2-19-12-14-20(15-13-19)26(30)28-16-6-9-23(18-28)21-7-5-8-22(17-21)25(29)27-24-10-3-4-11-24/h5,7-8,12-15,17,23-24H,2-4,6,9-11,16,18H2,1H3,(H,27,29) |
| InChIKey | SMXHTJUXBPFELA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |