C28H37N3O3 — CID 46334034
3-[3-(cycloheptylcarbamoyl)phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide (PubChem CID 46334034) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is 3-[3-(cycloheptylcarbamoyl)phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 3-[3-(cycloheptylcarbamoyl)phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46334034 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | 3-[3-(cycloheptylcarbamoyl)phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CCCC(c3cccc(C(=O)NC4CCCCCC4)c3)C2)cc1 |
| InChI | InChI=1S/C28H37N3O3/c1-2-34-26-16-14-25(15-17-26)30-28(33)31-18-8-11-23(20-31)21-9-7-10-22(19-21)27(32)29-24-12-5-3-4-6-13-24/h7,9-10,14-17,19,23-24H,2-6,8,11-13,18,20H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | QROBTXYJOWUCNA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |