C28H31N3O4 — CID 46334031
N-(4-ethoxyphenyl)-3-[3-[(4-methoxyphenyl)carbamoyl]phenyl]piperidine-1-carboxamide (PubChem CID 46334031) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-[3-[(4-methoxyphenyl)carbamoyl]phenyl]piperidine-1-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-3-[3-[(4-methoxyphenyl)carbamoyl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46334031 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-[3-[(4-methoxyphenyl)carbamoyl]phenyl]piperidine-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CCCC(c3cccc(C(=O)Nc4ccc(OC)cc4)c3)C2)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-3-35-26-15-11-24(12-16-26)30-28(33)31-17-5-8-22(19-31)20-6-4-7-21(18-20)27(32)29-23-9-13-25(34-2)14-10-23/h4,6-7,9-16,18,22H,3,5,8,17,19H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | HMNWRWWRVUJKSY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |