C27H31N3O4 — CID 46334076
N-(4-ethoxyphenyl)-3-[3-[2-(furan-2-yl)ethylcarbamoyl]phenyl]piperidine-1-carboxamide (PubChem CID 46334076) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-[3-[2-(furan-2-yl)ethylcarbamoyl]phenyl]piperidine-1-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-3-[3-[2-(furan-2-yl)ethylcarbamoyl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46334076 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-[3-[2-(furan-2-yl)ethylcarbamoyl]phenyl]piperidine-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CCCC(c3cccc(C(=O)NCCc4ccco4)c3)C2)cc1 |
| InChI | InChI=1S/C27H31N3O4/c1-2-33-25-12-10-23(11-13-25)29-27(32)30-16-4-8-22(19-30)20-6-3-7-21(18-20)26(31)28-15-14-24-9-5-17-34-24/h3,5-7,9-13,17-18,22H,2,4,8,14-16,19H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | IRLXKNXYYPUAEW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |