C27H28ClN3O3 — CID 92872501
(3S)-3-[3-[(3-chlorophenyl)carbamoyl]phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide (PubChem CID 92872501) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is (3S)-3-[3-[(3-chlorophenyl)carbamoyl]phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-[3-[(3-chlorophenyl)carbamoyl]phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 92872501 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (3S)-3-[3-[(3-chlorophenyl)carbamoyl]phenyl]-N-(4-ethoxyphenyl)piperidine-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CCC[C@@H](c3cccc(C(=O)Nc4cccc(Cl)c4)c3)C2)cc1 |
| InChI | InChI=1S/C27H28ClN3O3/c1-2-34-25-13-11-23(12-14-25)30-27(33)31-15-5-8-21(18-31)19-6-3-7-20(16-19)26(32)29-24-10-4-9-22(28)17-24/h3-4,6-7,9-14,16-17,21H,2,5,8,15,18H2,1H3,(H,29,32)(H,30,33)/t21-/m1/s1 |
| InChIKey | XAZCUNXEAPGLCT-OAQYLSRUSA-N |
| XLogP | 6.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |