C29H33N3O2 — CID 46334023
N-(4-ethylphenyl)-3-[3-[(4-methylphenyl)methylcarbamoyl]phenyl]piperidine-1-carboxamide (PubChem CID 46334023) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-[3-[(4-methylphenyl)methylcarbamoyl]phenyl]piperidine-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-3-[3-[(4-methylphenyl)methylcarbamoyl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46334023 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-(4-ethylphenyl)-3-[3-[(4-methylphenyl)methylcarbamoyl]phenyl]piperidine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCCC(c3cccc(C(=O)NCc4ccc(C)cc4)c3)C2)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-3-22-13-15-27(16-14-22)31-29(34)32-17-5-8-26(20-32)24-6-4-7-25(18-24)28(33)30-19-23-11-9-21(2)10-12-23/h4,6-7,9-16,18,26H,3,5,8,17,19-20H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | VETHWPNSWCWBHB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |