C26H26ClN3O3 — CID 52690342
N-[3-[[[2-[(2-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 52690342) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is N-[3-[[[2-[(2-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[2-[(2-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 52690342 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[3-[[[2-[(2-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)N2CCCC2)c1)c1ccccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H26ClN3O3/c27-23-12-3-1-9-20(23)18-33-24-13-4-2-11-22(24)25(31)28-17-19-8-7-10-21(16-19)29-26(32)30-14-5-6-15-30/h1-4,7-13,16H,5-6,14-15,17-18H2,(H,28,31)(H,29,32) |
| InChIKey | CPZDNCASBQRBFC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |