C25H26BrN3O3 — CID 55797280
2-[(2-bromophenyl)methoxy]-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]benzamide (PubChem CID 55797280) has the molecular formula C25H26BrN3O3 and a molecular weight of 496.41 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methoxy]-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]benzamide.
| Compound Name | 2-[(2-bromophenyl)methoxy]-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55797280 |
| Molecular Formula | C25H26BrN3O3 |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-[(2-bromophenyl)methoxy]-N-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]benzamide |
| SMILES | CN(C)CC(=O)Nc1cccc(CNC(=O)c2ccccc2OCc2ccccc2Br)c1 |
| InChI | InChI=1S/C25H26BrN3O3/c1-29(2)16-24(30)28-20-10-7-8-18(14-20)15-27-25(31)21-11-4-6-13-23(21)32-17-19-9-3-5-12-22(19)26/h3-14H,15-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | DFKALAWVAYIHSX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |