C12H15BrFNO2S — CID 103800654
4-bromo-3-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide (PubChem CID 103800654) has the molecular formula C12H15BrFNO2S and a molecular weight of 336.23 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide.
| Compound Name | 4-bromo-3-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 103800654 |
| Molecular Formula | C12H15BrFNO2S |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 4-bromo-3-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCCCO)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H15BrFNO2S/c13-10-3-2-9(8-11(10)14)12(17)15-4-7-18-6-1-5-16/h2-3,8,16H,1,4-7H2,(H,15,17) |
| InChIKey | HUKCMDVRJRKPTP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|