C13H15BrF3NO2S — CID 103819806
2-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 103819806) has the molecular formula C13H15BrF3NO2S and a molecular weight of 386.23 g/mol. Its IUPAC name is 2-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103819806 |
| Molecular Formula | C13H15BrF3NO2S |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 2-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCSCCCO)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H15BrF3NO2S/c14-11-3-2-9(13(15,16)17)8-10(11)12(20)18-4-7-21-6-1-5-19/h2-3,8,19H,1,4-7H2,(H,18,20) |
| InChIKey | VRSKEHATGHHUJF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|