C13H15BrF3NO2S — CID 115742493
2-bromo-N-(3-methylsulfinylbutyl)-5-(trifluoromethyl)benzamide (PubChem CID 115742493) has the molecular formula C13H15BrF3NO2S and a molecular weight of 386.23 g/mol. Its IUPAC name is 2-bromo-N-(3-methylsulfinylbutyl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-bromo-N-(3-methylsulfinylbutyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115742493 |
| Molecular Formula | C13H15BrF3NO2S |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 2-bromo-N-(3-methylsulfinylbutyl)-5-(trifluoromethyl)benzamide |
| SMILES | CC(CCNC(=O)c1cc(C(F)(F)F)ccc1Br)S(C)=O |
| InChI | InChI=1S/C13H15BrF3NO2S/c1-8(21(2)20)5-6-18-12(19)10-7-9(13(15,16)17)3-4-11(10)14/h3-4,7-8H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | RSAZJOQAKWFXIH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |