C13H15ClF3NO2S — CID 99632356
3-chloro-N-[(3R)-3-[(S)-methylsulfinyl]butyl]-5-(trifluoromethyl)benzamide (PubChem CID 99632356) has the molecular formula C13H15ClF3NO2S and a molecular weight of 341.78 g/mol. Its IUPAC name is 3-chloro-N-[(3R)-3-[(S)-methylsulfinyl]butyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[(3R)-3-[(S)-methylsulfinyl]butyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 99632356 |
| Molecular Formula | C13H15ClF3NO2S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-chloro-N-[(3R)-3-[(S)-methylsulfinyl]butyl]-5-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CCNC(=O)c1cc(Cl)cc(C(F)(F)F)c1)[S@](C)=O |
| InChI | InChI=1S/C13H15ClF3NO2S/c1-8(21(2)20)3-4-18-12(19)9-5-10(13(15,16)17)7-11(14)6-9/h5-8H,3-4H2,1-2H3,(H,18,19)/t8-,21+/m1/s1 |
| InChIKey | UAPNOARFJSAHHW-ZEDNOMKYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |