C13H13ClF3NO4 — CID 129359079
methyl (2S)-3-[[3-chloro-5-(trifluoromethyl)benzoyl]amino]-2-hydroxy-2-methylpropanoate (PubChem CID 129359079) has the molecular formula C13H13ClF3NO4 and a molecular weight of 339.70 g/mol. Its IUPAC name is methyl (2S)-3-[[3-chloro-5-(trifluoromethyl)benzoyl]amino]-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[[3-chloro-5-(trifluoromethyl)benzoyl]amino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 129359079 |
| Molecular Formula | C13H13ClF3NO4 |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl (2S)-3-[[3-chloro-5-(trifluoromethyl)benzoyl]amino]-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)[C@@](C)(O)CNC(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13ClF3NO4/c1-12(21,11(20)22-2)6-18-10(19)7-3-8(13(15,16)17)5-9(14)4-7/h3-5,21H,6H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | FJFYIOCLUQWKGB-LBPRGKRZSA-N |
| XLogP | 2.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |