C13H16Cl3NO — CID 114149347
3,5-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzamide (PubChem CID 114149347) has the molecular formula C13H16Cl3NO and a molecular weight of 308.64 g/mol. Its IUPAC name is 3,5-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzamide.
| Compound Name | 3,5-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzamide |
|---|---|
| PubChem CID | 114149347 |
| Molecular Formula | C13H16Cl3NO |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3,5-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzamide |
| SMILES | CC(C)(CCCl)CNC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl3NO/c1-13(2,3-4-14)8-17-12(18)9-5-10(15)7-11(16)6-9/h5-7H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | CUWQWTFWGCLNLB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|