C16H25NO2 — CID 122141755
N-(4-methoxy-2,2-dimethylbutyl)-3,5-dimethylbenzamide (PubChem CID 122141755) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(4-methoxy-2,2-dimethylbutyl)-3,5-dimethylbenzamide.
| Compound Name | N-(4-methoxy-2,2-dimethylbutyl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 122141755 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-(4-methoxy-2,2-dimethylbutyl)-3,5-dimethylbenzamide |
| SMILES | COCCC(C)(C)CNC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H25NO2/c1-12-8-13(2)10-14(9-12)15(18)17-11-16(3,4)6-7-19-5/h8-10H,6-7,11H2,1-5H3,(H,17,18) |
| InChIKey | AAENBJBSAHUDRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |