C14H20BrNO — CID 115364940
N-(3-bromo-2,2-dimethylpropyl)-3,5-dimethylbenzamide (PubChem CID 115364940) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)-3,5-dimethylbenzamide.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 115364940 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(C)(C)CBr)c1 |
| InChI | InChI=1S/C14H20BrNO/c1-10-5-11(2)7-12(6-10)13(17)16-9-14(3,4)8-15/h5-7H,8-9H2,1-4H3,(H,16,17) |
| InChIKey | WKVMHYSTPGRABD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|