C13H18BrNO2 — CID 107673135
N-(3-bromo-2,2-dimethylpropyl)-4-hydroxy-3-methylbenzamide (PubChem CID 107673135) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)-4-hydroxy-3-methylbenzamide.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)-4-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 107673135 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)-4-hydroxy-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCC(C)(C)CBr)ccc1O |
| InChI | InChI=1S/C13H18BrNO2/c1-9-6-10(4-5-11(9)16)12(17)15-8-13(2,3)7-14/h4-6,16H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | NFSCMBIWBUFRFO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|