C14H19BrClNO — CID 114149501
N-(4-bromo-2,2-dimethylbutyl)-4-chloro-3-methylbenzamide (PubChem CID 114149501) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)-4-chloro-3-methylbenzamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)-4-chloro-3-methylbenzamide |
|---|---|
| PubChem CID | 114149501 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)-4-chloro-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCC(C)(C)CCBr)ccc1Cl |
| InChI | InChI=1S/C14H19BrClNO/c1-10-8-11(4-5-12(10)16)13(18)17-9-14(2,3)6-7-15/h4-5,8H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | QCXVJAAIZBDCAA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|