C13H10ClF3N2O2 — CID 91649838
3-chloro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 91649838) has the molecular formula C13H10ClF3N2O2 and a molecular weight of 318.68 g/mol. Its IUPAC name is 3-chloro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91649838 |
| Molecular Formula | C13H10ClF3N2O2 |
| Molecular Weight | 318.68 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-chloro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | C#CCNC(=O)CNC(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10ClF3N2O2/c1-2-3-18-11(20)7-19-12(21)8-4-9(13(15,16)17)6-10(14)5-8/h1,4-6H,3,7H2,(H,18,20)(H,19,21) |
| InChIKey | OABPPVUMRCJXOF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|