C12H10ClN3O4 — CID 86796144
3-chloro-4-nitro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide (PubChem CID 86796144) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 3-chloro-4-nitro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide.
| Compound Name | 3-chloro-4-nitro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 86796144 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-chloro-4-nitro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
| SMILES | C#CCNC(=O)CNC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C12H10ClN3O4/c1-2-5-14-11(17)7-15-12(18)8-3-4-10(16(19)20)9(13)6-8/h1,3-4,6H,5,7H2,(H,14,17)(H,15,18) |
| InChIKey | YBVHMLMBQCOFTA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|