C19H14ClF3N4O2 — CID 123771134
3-chloro-N-[2-[2-(1H-indol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 123771134) has the molecular formula C19H14ClF3N4O2 and a molecular weight of 422.79 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(1H-indol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[2-[2-(1H-indol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123771134 |
| Molecular Formula | C19H14ClF3N4O2 |
| Molecular Weight | 422.79 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 3-chloro-N-[2-[2-(1H-indol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cc(Cl)cc(C(F)(F)F)c1)NN=Cc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H14ClF3N4O2/c20-15-7-13(6-14(8-15)19(21,22)23)18(29)25-10-17(28)27-26-9-11-1-2-16-12(5-11)3-4-24-16/h1-9,24H,10H2,(H,25,29)(H,27,28) |
| InChIKey | DEFSWAALDBFAEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|