C25H18ClF3N4O2 — CID 137047797
3-chloro-N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 137047797) has the molecular formula C25H18ClF3N4O2 and a molecular weight of 498.89 g/mol. Its IUPAC name is 3-chloro-N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137047797 |
| Molecular Formula | C25H18ClF3N4O2 |
| Molecular Weight | 498.89 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 3-chloro-N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cc(Cl)cc(C(F)(F)F)c1)NN=Cc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H18ClF3N4O2/c26-18-11-16(10-17(12-18)25(27,28)29)24(35)30-14-22(34)33-31-13-20-19-8-4-5-9-21(19)32-23(20)15-6-2-1-3-7-15/h1-13,32H,14H2,(H,30,35)(H,33,34) |
| InChIKey | WQMOZRKLFZLFJX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|