C23H17F3N4S — CID 136746274
1-[(Z)-(2-phenyl-1H-indol-3-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 136746274) has the molecular formula C23H17F3N4S and a molecular weight of 438.48 g/mol. Its IUPAC name is 1-[(Z)-(2-phenyl-1H-indol-3-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-(2-phenyl-1H-indol-3-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 136746274 |
| Molecular Formula | C23H17F3N4S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-[(Z)-(2-phenyl-1H-indol-3-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccccc1NC(=S)N/N=C\c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H17F3N4S/c24-23(25,26)18-11-5-7-13-20(18)29-22(31)30-27-14-17-16-10-4-6-12-19(16)28-21(17)15-8-2-1-3-9-15/h1-14,28H,(H2,29,30,31)/b27-14- |
| InChIKey | QCPSHYHTHRMICA-VYYCAZPPSA-N |
| XLogP | 6.17 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|