C27H29N5O3S — CID 137333658
1-[4-(dimethylamino)phenyl]-3-[(E)-[2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]methylideneamino]thiourea (PubChem CID 137333658) has the molecular formula C27H29N5O3S and a molecular weight of 503.63 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[(E)-[2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]methylideneamino]thiourea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[(E)-[2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 137333658 |
| Molecular Formula | C27H29N5O3S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[(E)-[2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]methylideneamino]thiourea |
| SMILES | COc1cc(-c2[nH]c3ccccc3c2/C=N/NC(=S)Nc2ccc(N(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H29N5O3S/c1-32(2)19-12-10-18(11-13-19)29-27(36)31-28-16-21-20-8-6-7-9-22(20)30-25(21)17-14-23(33-3)26(35-5)24(15-17)34-4/h6-16,30H,1-5H3,(H2,29,31,36)/b28-16+ |
| InChIKey | VEQMUQGMWGJKRP-LQKURTRISA-N |
| XLogP | 5.25 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|