C24H22BrN5S — CID 137333629
1-[(E)-[2-(4-bromophenyl)-1H-indol-3-yl]methylideneamino]-3-[4-(dimethylamino)phenyl]thiourea (PubChem CID 137333629) has the molecular formula C24H22BrN5S and a molecular weight of 492.45 g/mol. Its IUPAC name is 1-[(E)-[2-(4-bromophenyl)-1H-indol-3-yl]methylideneamino]-3-[4-(dimethylamino)phenyl]thiourea.
| Compound Name | 1-[(E)-[2-(4-bromophenyl)-1H-indol-3-yl]methylideneamino]-3-[4-(dimethylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 137333629 |
| Molecular Formula | C24H22BrN5S |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 1-[(E)-[2-(4-bromophenyl)-1H-indol-3-yl]methylideneamino]-3-[4-(dimethylamino)phenyl]thiourea |
| SMILES | CN(C)c1ccc(NC(=S)N/N=C/c2c(-c3ccc(Br)cc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H22BrN5S/c1-30(2)19-13-11-18(12-14-19)27-24(31)29-26-15-21-20-5-3-4-6-22(20)28-23(21)16-7-9-17(25)10-8-16/h3-15,28H,1-2H3,(H2,27,29,31)/b26-15+ |
| InChIKey | VTMURUIHYOBRAT-CVKSISIWSA-N |
| XLogP | 5.98 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|