C27H24N6OS — CID 135798596
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea (PubChem CID 135798596) has the molecular formula C27H24N6OS and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135798596 |
| Molecular Formula | C27H24N6OS |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea |
| SMILES | Cc1c(NC(=S)N/N=C/c2c(-c3ccccc3)[nH]c3ccccc23)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H24N6OS/c1-18-24(26(34)33(32(18)2)20-13-7-4-8-14-20)30-27(35)31-28-17-22-21-15-9-10-16-23(21)29-25(22)19-11-5-3-6-12-19/h3-17,29H,1-2H3,(H2,30,31,35)/b28-17+ |
| InChIKey | AFXJATUNNVRBMA-OGLMXYFKSA-N |
| XLogP | 4.95 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|